CAS
82278-73-7 Purity
---
82278-73-7 Purity
---
Shopping basket
3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride
CAS
954239-19-1
Catalog Number
ACM954239191
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride?
The molecular formula is C6H9BrClN3.
What is the PubChem CID of 3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride?
The PubChem CID is 44118289.
What is the molecular weight of 3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride?
The molecular weight is 238.51 g/mol.
What is the IUPAC name of 3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride?
The IUPAC name is 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine;hydrochloride.
What is the InChI of 3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride?
The InChI is InChI=1S/C6H8BrN3.ClH/c7-5-3-9-6-4-8-1-2-10(5)6;/h3,8H,1-2,4H2;1H.
What is the InChIKey of 3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride?
The InChIKey is DHCCQMBHQKWEMJ-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride?
The Canonical SMILES is C1CN2C(=NC=C2Br)CN1.Cl.
What is the CAS number of 3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride?
The CAS number is 1187830-45-0.
What is the hydrogen bond donor count of 3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride?
The hydrogen bond donor count is 2.
What is the hydrogen bond acceptor count of 3-Bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine hydrochloride?
The hydrogen bond acceptor count is 2.
Please kindly note that our products are for research use only.
Recommended Products
