The molecular formula of the compound is C14H18BrNO4.
What is the molecular weight of the compound?
The molecular weight of the compound is 344.20 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2S)-3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
What is the CAS number of the compound?
The CAS number of the compound is 82278-73-7.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C14H18BrNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-5-4-6-10(15)7-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1.
What is the InChIKey of the compound?
The InChIKey of the compound is FBUDYESOPLBQIR-NSHDSACASA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CC(C)(C)OC(=O)NC(CC1=CC(=CC=C1)Br)C(=O)O.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.2.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 2.
Is the compound covalently-bonded?
Yes, the compound is covalently-bonded.
※ Please kindly note that our products are for research use only.