3-[Acetyl(methyl)amino]propanoic acid

• Catalog Number: ACMA00001373
• Category: Amines
• Molecular Weight: 145.16
• Molecular Formula: C₆H₁₁BrN₂S
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C6H11NO3.

What is the molecular weight of the compound?

The molecular weight is 145.16 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 3-[acetyl(methyl)amino]propanoic acid.

What is the InChI of the compound?

The InChI is InChI=1S/C6H11NO3/c1-5(8)7(2)4-3-6(9)10/h3-4H2,1-2H3,(H,9,10).

What is the InChIKey of the compound?

The InChIKey is CUAUMKXJKVIJHG-UHFFFAOYSA-N.

What is the CAS number of the compound?

The CAS number is 58706-66-4.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is -0.8.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 3 rotatable bond counts.