What is the PubChem CID of the compound?
The PubChem CID of the compound is 6950945.
What is the molecular formula of the compound?
The molecular formula of the compound is C6H11NO3.
What are the synonyms of the compound?
The synonyms of the compound are N-Formyl-L-valine, FOR-VAL-OH, (2S)-2-formamido-3-methylbutanoic acid, and Formyl-L-Valine.
What is the molecular weight of the compound?
The molecular weight of the compound is 145.16 g/mol.
When was the compound created in PubChem?
The compound was created in PubChem on July 28, 2006.
When was the compound last modified in PubChem?
The compound was last modified in PubChem on November 25, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2S)-2-formamido-3-methylbutanoic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C6H11NO3/c1-4(2)5(6(9)10)7-3-8/h3-5H,1-2H3,(H,7,8)(H,9,10)/t5-/m0/s1.
What is the InChIKey of the compound?
The InChIKey of the compound is QBYYLBWFBPAOKU-YFKPBYRVSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(C)C(C(=O)O)NC=O.