1,3-Benzodioxole-5-carbohydrazide

• Catalog Number: ACMA00002739
• Category: Ethers
• Molecular Weight: 180.16
• Molecular Formula: C₈H₈O₃
• Hazard Statements: H317-H319
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1,3-Benzodioxole-5-carbohydrazide?

The molecular formula is C8H8N2O3.

What is the molecular weight of 1,3-Benzodioxole-5-carbohydrazide?

The molecular weight is 180.16 g/mol.

What is the IUPAC name of 1,3-Benzodioxole-5-carbohydrazide?

The IUPAC name is 1,3-benzodioxole-5-carbohydrazide.

What is the InChI of 1,3-Benzodioxole-5-carbohydrazide?

The InChI is InChI=1S/C8H8N2O3/c9-10-8(11)5-1-2-6-7(3-5)13-4-12-6/h1-3H,4,9H2,(H,10,11).

What is the InChIKey of 1,3-Benzodioxole-5-carbohydrazide?

The InChIKey is RAXBGBHBUFGWPG-UHFFFAOYSA-N.

What is the Canonical SMILES of 1,3-Benzodioxole-5-carbohydrazide?

The Canonical SMILES is C1OC2=C(O1)C=C(C=C2)C(=O)NN.

What is the CAS number of 1,3-Benzodioxole-5-carbohydrazide?

The CAS number is 22026-39-7.

What is the EC number of 1,3-Benzodioxole-5-carbohydrazide?

The EC number is 674-079-0.

What is the ChEMBL ID of 1,3-Benzodioxole-5-carbohydrazide?

The ChEMBL ID is CHEMBL1957530.

Is 1,3-Benzodioxole-5-carbohydrazide a canonicalized compound?

Yes, it is a canonicalized compound.