What is the molecular formula of 2-Amino-4-nitro-5-methoxybenzoic acid?
The molecular formula of 2-Amino-4-nitro-5-methoxybenzoic acid is C8H8N2O5.
What are the synonyms of 2-Amino-4-nitro-5-methoxybenzoic acid?
The synonyms of 2-Amino-4-nitro-5-methoxybenzoic acid are 2-Amino-5-methoxy-4-nitrobenzoic acid, Benzoic acid, 2-amino-5-methoxy-4-nitro-, and MFCD10568169.
What is the molecular weight of 2-Amino-4-nitro-5-methoxybenzoic acid?
The molecular weight of 2-Amino-4-nitro-5-methoxybenzoic acid is 212.16 g/mol.
When was 2-Amino-4-nitro-5-methoxybenzoic acid created?
2-Amino-4-nitro-5-methoxybenzoic acid was created on December 5, 2007.
What is the IUPAC name of 2-Amino-4-nitro-5-methoxybenzoic acid?
The IUPAC name of 2-Amino-4-nitro-5-methoxybenzoic acid is 2-amino-5-methoxy-4-nitrobenzoic acid.
What is the InChI key of 2-Amino-4-nitro-5-methoxybenzoic acid?
The InChI key of 2-Amino-4-nitro-5-methoxybenzoic acid is SDGOTDAQMBDEOT-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-4-nitro-5-methoxybenzoic acid?
The canonical SMILES of 2-Amino-4-nitro-5-methoxybenzoic acid is COC1=C(C=C(C(=C1)C(=O)O)N)[N+](=O)[O-].
What is the CAS number of 2-Amino-4-nitro-5-methoxybenzoic acid?
The CAS number of 2-Amino-4-nitro-5-methoxybenzoic acid is 196194-99-7.
What is the XLogP3 value of 2-Amino-4-nitro-5-methoxybenzoic acid?
The XLogP3 value of 2-Amino-4-nitro-5-methoxybenzoic acid is 1.6.
What is the hydrogen bond donor count of 2-Amino-4-nitro-5-methoxybenzoic acid?
The hydrogen bond donor count of 2-Amino-4-nitro-5-methoxybenzoic acid is 2.
※ Please kindly note that our products are for research use only.