Tixocortol

• CAS: 61951-99-3
• Catalog Number: ACM61951993
• Category: Other Products
• Molecular Weight: 378.53
• Molecular Formula: C₂₁H₃₀O₄S
• Synonyms: (11β)-11,17-Dihydroxy-21-Mercaptopregn-4-ene-3,20-dione;11β,17-Dihydroxy-21-Mercaptoprogesterone;Cortisol 21-Thiol

Custom Q&A

What is the molecular formula of Tixocortol?

The molecular formula of Tixocortol is C21H30O4S.

What is the molecular weight of Tixocortol?

The molecular weight of Tixocortol is 378.5 g/mol.

What is the IUPAC name of Tixocortol?

The IUPAC name of Tixocortol is (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-17-(2-sulfanylacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.

What is the InChIKey of Tixocortol?

The InChIKey of Tixocortol is YWDBSCORAARPPF-VWUMJDOOSA-N.

What is the Canonical SMILES representation of Tixocortol?

The Canonical SMILES representation of Tixocortol is CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4(C(=O)CS)O)C)O.

What is the CAS number of Tixocortol?

The CAS number of Tixocortol is 61951-99-3.

How many hydrogen bond donor counts does Tixocortol have?

Tixocortol has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Tixocort have?

Tixocortol has 5 hydrogen bond acceptor counts.

What is the exact mass of Tixocortol?

The exact mass of Tixocortol is 378.18648061 g/mol.

What is the topological polar surface area of Tixocortol?

The topological polar surface area of Tixocortol is 75.6 Ų.