Boc-2-Aminopyridine-4-boronicacidpinacolester

• CAS: 1095708-32-9
• Catalog Number: ACM1095708329
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of Boc-2-Aminopyridine-4-boronicacidpinacolester?

The molecular formula is C16H27BN2O5.

What are the synonyms of Boc-2-Aminopyridine-4-boronicacidpinacolester?

The synonyms are BCP10092, AKOS015995505, and N-tert-butyl-N-[3-(tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]carbaMate.

What is the molecular weight of Boc-2-Aminopyridine-4-boronicacidpinacolester?

The molecular weight is 338.2 g/mol.

What is the IUPAC name of Boc-2-Aminopyridine-4-boronicacidpinacolester?

The IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-[(2-methylpropan-2-yl)oxycarbonylamino]pyridin-4-yl]borinic acid.

What is the InChI of Boc-2-Aminopyridine-4-boronicacidpinacolester?

The InChI is InChI=1S/C16H27BN2O5/c1-14(2,3)23-13(20)19-12-10-11(8-9-18-12)17(22)24-16(6,7)15(4,5)21/h8-10,21-22H,1-7H3,(H,18,19,20).

What is the InChIKey of Boc-2-Aminopyridine-4-boronicacidpinacolester?

The InChIKey is ZVYRJZWPPRVOAH-UHFFFAOYSA-N.

What is the canonical SMILES of Boc-2-Aminopyridine-4-boronicacidpinacolester?

The canonical SMILES is B(C1=CC(=NC=C1)NC(=O)OC(C)(C)C)(O)OC(C)(C)C(C)(C)O.

What is the hydrogen bond donor count of Boc-2-Aminopyridine-4-boronicacidpinacolester?

The hydrogen bond donor count is 3.

What is the hydrogen bond acceptor count of Boc-2-Aminopyridine-4-boronicacidpinacolester?

The hydrogen bond acceptor count is 6.

What is the rotatable bond count of Boc-2-Aminopyridine-4-boronicacidpinacolester?

The rotatable bond count is 7.