4-(N,N-diethylaminocarbonyl)phenylboronic acid

• CAS: 389621-80-1
• Catalog Number: ACM389621801
• Category: Boro-Amino Acids
• Molecular Weight: 221.06
• Molecular Formula: C₁₁H₁₆BNO₃

Custom Q&A

What is the molecular formula of 4-(N,N-diethylaminocarbonyl)phenylboronic acid?

The molecular formula is C11H16BNO3.

What is the molecular weight of 4-(N,N-diethylaminocarbonyl)phenylboronic acid?

The molecular weight is 221.06 g/mol.

What is the IUPAC name of 4-(N,N-diethylaminocarbonyl)phenylboronic acid?

The IUPAC name is [4-(diethylcarbamoyl)phenyl]boronic acid.

What is the InChI of 4-(N,N-diethylaminocarbonyl)phenylboronic acid?

The InChI is InChI=1S/C11H16BNO3/c1-3-13(4-2)11(14)9-5-7-10(8-6-9)12(15)16/h5-8,15-16H,3-4H2,1-2H3.

What is the InChIKey of 4-(N,N-diethylaminocarbonyl)phenylboronic acid?

The InChIKey is ZCGVBHIMRVYWOH-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(N,N-diethylaminocarbonyl)phenylboronic acid?

The canonical SMILES is B(C1=CC=C(C=C1)C(=O)N(CC)CC)(O)O.

What is the CAS number of 4-(N,N-diethylaminocarbonyl)phenylboronic acid?

The CAS number is 389621-80-1.

What is the European Community (EC) number of 4-(N,N-diethylaminocarbonyl)phenylboronic acid?

The EC number is 808-086-9.

What is the hydrogen bond donor count of 4-(N,N-diethylaminocarbonyl)phenylboronic acid?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of 4-(N,N-diethylaminocarbonyl)phenylboronic acid?

The hydrogen bond acceptor count is 3.