CAS
108052-76-2 Purity
98%
108052-76-2 Purity
98%
Shopping basket
2,5-Dibromo-3-fluoropyridine
CAS
156772-60-0
Catalog Number
ACM156772600
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,5-Dibromo-3-fluoropyridine?
The molecular formula of 2,5-Dibromo-3-fluoropyridine is C5H2Br2FN.
What is the molecular weight of 2,5-Dibromo-3-fluoropyridine?
The molecular weight of 2,5-Dibromo-3-fluoropyridine is 254.88 g/mol.
What is the IUPAC Name of 2,5-Dibromo-3-fluoropyridine?
The IUPAC Name of 2,5-Dibromo-3-fluoropyridine is 2,5-dibromo-3-fluoropyridine.
What is the InChI of 2,5-Dibromo-3-fluoropyridine?
The InChI of 2,5-Dibromo-3-fluoropyridine is InChI=1S/C5H2Br2FN/c6-3-1-4(8)5(7)9-2-3/h1-2H.
What is the InChIKey of 2,5-Dibromo-3-fluoropyridine?
The InChIKey of 2,5-Dibromo-3-fluoropyridine is QEENLQKOTDHQEW-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dibromo-3-fluoropyridine?
The canonical SMILES of 2,5-Dibromo-3-fluoropyridine is C1=C(C=NC(=C1F)Br)Br.
What is the CAS number of 2,5-Dibromo-3-fluoropyridine?
The CAS number of 2,5-Dibromo-3-fluoropyridine is 156772-60-0.
What is the EC number of 2,5-Dibromo-3-fluoropyridine?
The EC number of 2,5-Dibromo-3-fluoropyridine is 813-205-2.
Is 2,5-Dibromo-3-fluoropyridine a canonicalized compound?
Yes, 2,5-Dibromo-3-fluoropyridine is a canonicalized compound.
Recommended Products
![4-(3-Bromophenyl)dibenzo[b,d]thiophene](https://resource.alfa-chemistry.com/structure/1084334-28-0.gif)
