1-Benzo[b]thien-4-yl-piperazine hydrochloride

• CAS: 913614-18-3
• Catalog Number: ACM913614183
• Category: Thiophenes
• Molecular Weight: 254.8
• Molecular Formula: C12H14N2S·HCl
• Synonyms: 1-(1-Benzothiophen-4-yl)piperazine hydrochloride
• Appearance: White Solid

Custom Q&A

What is the molecular formula of 1-Benzo[b]thien-4-yl-piperazine hydrochloride?

The molecular formula is C12H15ClN2S.

What is the molecular weight of 1-Benzo[b]thien-4-yl-piperazine hydrochloride?

The molecular weight is 254.78 g/mol.

What is the IUPAC Name of 1-Benzo[b]thien-4-yl-piperazine hydrochloride?

The IUPAC Name is 1-(1-benzothiophen-4-yl)piperazine hydrochloride.

What is the InChI of 1-Benzo[b]thien-4-yl-piperazine hydrochloride?

The InChI is InChI=1S/C12H14N2S.ClH/c1-2-11(14-7-5-13-6-8-14)10-4-9-15-12(10)3-1;/h1-4,9,13H,5-8H2;1H.

What is the InChIKey of 1-Benzo[b]thien-4-yl-piperazine hydrochloride?

The InChIKey is XDUUWPNOUUQXBX-UHFFFAOYSA-N.

What is the Canonical SMILES of 1-Benzo[b]thien-4-yl-piperazine hydrochloride?

The Canonical SMILES is C1CN(CCN1)C2=C3C=CSC3=CC=C2.Cl.

What is the CAS number of 1-Benzo[b]thien-4-yl-piperazine hydrochloride?

The CAS number is 913614-18-3.

What is the European Community (EC) Number of 1-Benzo[b]thien-4-yl-piperazine hydrochloride?

The European Community (EC) Number is 812-454-4.

What is the hydrogen bond donor count of 1-Benzo[b]thien-4-yl-piperazine hydrochloride?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of 1-Benzo[b]thien-4-yl-piperazine hydrochloride?

The hydrogen bond acceptor count is 3.