Methyl beta-(dimethylamino)isobutyrate

• Catalog Number: ACMA00003004
• Category: Ethers
• Molecular Weight: 145.20
• Molecular Formula: C₇H₁₁NO₃
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of Methyl beta-(dimethylamino)isobutyrate?

The molecular formula is C7H15NO2.

What is the IUPAC Name of Methyl beta-(dimethylamino)isobutyrate?

The IUPAC Name is methyl 3-(dimethylamino)-2-methylpropanoate.

What is the InChI of Methyl beta-(dimethylamino)isobutyrate?

The InChI is InChI=1S/C7H15NO2/c1-6(5-8(2)3)7(9)10-4/h6H,5H2,1-4H3.

What is the InChIKey of Methyl beta-(dimethylamino)isobutyrate?

The InChIKey is DDLJXUCYCFDNCA-UHFFFAOYSA-N.

What is the CAS number of Methyl beta-(dimethylamino)isobutyrate?

The CAS number is 10205-34-2.

What is the molecular weight of Methyl beta-(dimethylamino)isobutyrate?

The molecular weight is 145.20 g/mol.

What is the XLogP3-AA value of Methyl beta-(dimethylamino)isobutyrate?

The XLogP3-AA value is 0.7.

How many hydrogen bond donor counts does Methyl beta-(dimethylamino)isobutyrate have?

It has zero hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Methyl beta-(dimethylamino)isobutyrate have?

It has three hydrogen bond acceptor counts.

How many rotatable bond counts does Methyl beta-(dimethylamino)isobutyrate have?

It has four rotatable bond counts.