CAS
98645-48-8 Purity
---
98645-48-8 Purity
---
Shopping basket
2-Amino-4-methoxy-nicotinonitrile
CAS
98651-70-8
Catalog Number
ACM98651708
Category
Other Products
Molecular Weight
149.1
Molecular Formula
C7H7N3O
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Amino-4-methoxy-nicotinonitrile?
The molecular formula of 2-Amino-4-methoxy-nicotinonitrile is C7H7N3O.
What is the molecular weight of 2-Amino-4-methoxy-nicotinonitrile?
The molecular weight of 2-Amino-4-methoxy-nicotinonitrile is 149.15 g/mol.
When was 2-Amino-4-methoxy-nicotinonitrile created?
2-Amino-4-methoxy-nicotinonitrile was created on July 19, 2005.
What is the InChI for 2-Amino-4-methoxy-nicotinonitrile?
The InChI for 2-Amino-4-methoxy-nicotinonitrile is InChI=1S/C7H7N3O/c1-11-6-2-3-10-7(9)5(6)4-8/h2-3H,1H3,(H2,9,10).
What is the Canonical SMILES for 2-Amino-4-methoxy-nicotinonitrile?
The Canonical SMILES for 2-Amino-4-methoxy-nicotinonitrile is COC1=C(C(=NC=C1)N)C#N.
What is the CAS number for 2-Amino-4-methoxy-nicotinonitrile?
The CAS number for 2-Amino-4-methoxy-nicotinonitrile is 98651-70-8.
What is the XLogP3-AA value for 2-Amino-4-methoxy-nicotinonitrile?
The XLogP3-AA value for 2-Amino-4-methoxy-nicotinonitrile is 0.7.
How many hydrogen bond acceptors are there in 2-Amino-4-methoxy-nicotinonitrile?
There are 4 hydrogen bond acceptors in 2-Amino-4-methoxy-nicotinonitrile.
Is 2-Amino-4-methoxy-nicotinonitrile a canonicalized compound?
Yes, 2-Amino-4-methoxy-nicotinonitrile is a canonicalized compound.
What is the topological polar surface area of 2-Amino-4-methoxy-nicotinonitrile?
The topological polar surface area of 2-Amino-4-methoxy-nicotinonitrile is 71.9 Ų.
When was 2-Amino-4-methoxy-nicotinonitrile created in PubChem?
It was created on 2005-07-19.
What is the IUPAC name of 2-Amino-4-methoxy-nicotinonitrile?
The IUPAC name is 2-amino-4-methoxypyridine-3-carbonitrile.
What is the InChIKey of 2-Amino-4-methoxy-nicotinonitrile?
The InChIKey is ULYBLKYAFIOZRK-UHFFFAOYSA-N.
How many hydrogen bond donor counts are there in 2-Amino-4-methoxy-nicotinonitrile?
There is 1 hydrogen bond donor count.
What is the exact mass of 2-Amino-4-methoxy-nicotinonitrile?
The exact mass is 149.058911855 g/mol.
Is the compound canonicalized?
Yes, the compound is canonicalized.
How many topological polar surface areas are there in 2-Amino-4-methoxy-nicotinonitrile?
The topological polar surface area is 71.9 Ų.
How many covalently-bonded unit counts are there in 2-Amino-4-methoxy-nicotinonitrile?
There is 1 covalently-bonded unit count.
Recommended Products
![4'-Nitro-[1,1'-biphenyl]-4-carboxaldehyde](https://resource.alfa-chemistry.com/structure/98648-23-8.gif)
