CAS
97480-55-2 Purity
---
97480-55-2 Purity
---
Shopping basket
Tolclofos-methyl oxon
CAS
97483-08-4
Catalog Number
ACM97483084
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of tolclofos-methyl oxon?
The molecular formula of tolclofos-methyl oxon is C9H11Cl2O3P.
What is the molecular weight of tolclofos-methyl oxon?
The molecular weight of tolclofos-methyl oxon is 269.06 g/mol.
What is the IUPAC name of tolclofos-methyl oxon?
The IUPAC name of tolclofos-methyl oxon is 1,3-dichloro-2-dimethoxyphosphoryl-5-methylbenzene.
What is the InChI of tolclofos-methyl oxon?
The InChI of tolclofos-methyl oxon is InChI=1S/C9H11Cl2O3P/c1-6-4-7(10)9(8(11)5-6)15(12,13-2)14-3/h4-5H,1-3H3.
What is the InChIKey of tolclofos-methyl oxon?
The InChIKey of tolclofos-methyl oxon is AQJZAMCZWYHWMG-UHFFFAOYSA-N.
What is the canonical SMILES of tolclofos-methyl oxon?
The canonical SMILES of tolclofos-methyl oxon is CC1=CC(=C(C(=C1)Cl)P(=O)(OC)OC)Cl.
What is the XLogP3-AA value of tolclofos-methyl oxon?
The XLogP3-AA value of tolclofos-methyl oxon is 2.7.
How many hydrogen bond donor counts does tolclofos-methyl oxon have?
Tolclofos-methyl oxon does not have any hydrogen bond donor counts.
How many hydrogen bond acceptor counts does tolclofos-methyl oxon have?
Tolclofos-methyl oxon has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does tolclofos-methyl oxon have?
Tolclofos-methyl oxon has 3 rotatable bond counts.
Recommended Products
![2-[7-(4-Methylsulfanylbenzoyl)-1-benzofuran-5-yl]acetic acid](https://resource.alfa-chemistry.com/structure/97483-17-5.gif)
CAS
97483-17-5 Purity
---
97483-17-5 Purity
---
![Thiazolo[4,5-g]quinazoline(9ci)](https://resource.alfa-chemistry.com/structure/97489-86-6.gif)
