CAS
96152-48-6 Purity
---
96152-48-6 Purity
---
Shopping basket
Benzene,1,2-dimethyl-3-(1-methylethyl)-5-nitro-
CAS
96155-98-5
Catalog Number
ACM96155985
Category
Other Products
Molecular Weight
193.2423
Molecular Formula
C11H15NO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
1,2-Dimethyl-3-(1-Methylethyl)-5-Nitrobenzene;BENZENE,1,2-DIMETHYL-3-(1-METHYLETHYL)-5-NITRO
What is the molecular formula of the compound?
The molecular formula of the compound is C11H15NO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 193.24 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1,2-dimethyl-5-nitro-3-propan-2-ylbenzene.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H15NO2/c1-7(2)11-6-10(12(13)14)5-8(3)9(11)4/h5-7H,1-4H3.
What is the InChIKey of the compound?
The InChIKey of the compound is LWXYRCYAGNMAMJ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=CC(=CC(=C1C)C(C)C)[N+](=O)[O-].
What is the CAS number of the compound?
The CAS number of the compound is 96155-98-5.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.6.
How many hydrogen bond donors does the compound have?
The compound does not have any hydrogen bond donors.
How many hydrogen bond acceptors does the compound have?
The compound has two hydrogen bond acceptors.
Please kindly note that our products are for research use only.
Recommended Products
