CAS
957035-08-4 Purity
---
957035-08-4 Purity
---
Shopping basket
3-(4-Bromo-1H-pyrazol-1-yl)-6-chloropyridazine
CAS
957035-33-5
Catalog Number
ACM957035335
Category
Other Products
Molecular Weight
259.5
Molecular Formula
C7H4BrClN4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C7H4BrClN4.
What is the molecular weight of the compound?
The molecular weight of the compound is 259.49 g/mol.
When was the compound created and last modified in PubChem?
The compound was created on 2009-05-28 and last modified on 2023-12-30.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-(4-bromopyrazol-1-yl)-6-chloropyridazine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H4BrClN4/c8-5-3-10-13(4-5)7-2-1-6(9)11-12-7/h1-4H.
What is the InChIKey of the compound?
The InChIKey of the compound is KPQXONXRLAIKLB-UHFFFAOYSA-N.
How many hydrogen bond acceptors does the compound have?
The compound has 3 hydrogen bond acceptors.
What is the exact mass of the compound?
The exact mass of the compound is 257.93079 g/mol.
How many heavy atoms does the compound contain?
The compound contains 13 heavy atoms.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem (release 2011.04.04).
Recommended Products
