CAS
93319-65-4 Purity
---
93319-65-4 Purity
---
Shopping basket
2,3-Diphenylpyridine hydrochloride
CAS
93324-69-7
Catalog Number
ACM93324697
Category
Other Products
Molecular Formula
C17H14NCl
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,3-Diphenylpyridine hydrochloride?
The molecular formula of 2,3-Diphenylpyridine hydrochloride is C17H14ClN.
When was 2,3-Diphenylpyridine hydrochloride created?
2,3-Diphenylpyridine hydrochloride was created on July 19, 2005.
What is the molecular weight of 2,3-Diphenylpyridine hydrochloride?
The molecular weight of 2,3-Diphenylpyridine hydrochloride is 267.8 g/mol.
What are the component compounds of 2,3-Diphenylpyridine hydrochloride?
The component compounds are CID 118476 (2,3-Diphenylpyridine) and CID 313 (Hydrochloric Acid).
What is the Canonical SMILES representation of 2,3-Diphenylpyridine hydrochloride?
The Canonical SMILES representation is C1=CC=C(C=C1)C2=C(N=CC=C2)C3=CC=CC=C3.Cl.
How many hydrogen bond donor counts does 2,3-Diphenylpyridine hydrochloride have?
2,3-Diphenylpyridine hydrochloride has 1 hydrogen bond donor count.
What is the exact mass of 2,3-Diphenylpyridine hydrochloride?
The exact mass of 2,3-Diphenylpyridine hydrochloride is 267.0814771 g/mol.
Does 2,3-Diphenylpyridine hydrochloride have any defined atom stereocenters?
No, 2,3-Diphenylpyridine hydrochloride does not have any defined atom stereocenters.
How many rotatable bond counts does 2,3-Diphenylpyridine hydrochloride have?
2,3-Diphenylpyridine hydrochloride has 2 rotatable bond counts.
Is 2,3-Diphenylpyridine hydrochloride considered canonicalized?
Yes, 2,3-Diphenylpyridine hydrochloride is considered canonicalized.
Recommended Products
CAS
933202-27-8 Purity
---
933202-27-8 Purity
---
