Carboxyethyltrichlorogermane

• CAS: 15961-23-6
• Catalog Number: ACM15961236
• Category: Organic Germanium
• Molecular Weight: 252.07
• Molecular Formula: C₃H₅Cl₃GeO₂
• Synonyms: CARBOXYETHYLTRICHLOROGERMANE;TRICHLOROGERMYLPROPANOIC ACID;3-(trichlorogermyl)-propanoicaci;3-(trichlorogermyl)propionic acid;3-(Trichlorogermyl)propanoic acid;Trichloro(2-carboxyethyl) germanium;Einecs 240-096-3;Propanoic acid, 3-(trichlorogermyl)-

Custom Q&A

What is the molecular formula of Carboxyethyltrichlorogermane?

The molecular formula of Carboxyethyltrichlorogermane is C3H5Cl3GeO2.

What is the molecular weight of Carboxyethyltrichlorogermane?

The molecular weight of Carboxyethyltrichlorogermane is 252.1 g/mol.

What is the IUPAC name of Carboxyethyltrichlorogermane?

The IUPAC name of Carboxyethyltrichlorogermane is 3-trichlorogermylpropanoic acid.

What is the InChI of Carboxyethyltrichlorogermane?

The InChI of Carboxyethyltrichlorogermane is InChI=1S/C3H5Cl3GeO2/c4-7(5,6)2-1-3(8)9/h1-2H2,(H,8,9).

What is the InChIKey of Carboxyethyltrichlorogermane?

The InChIKey of Carboxyethyltrichlorogermane is NLIJOIUVZBYQRS-UHFFFAOYSA-N.

What is the Canonical SMILES of Carboxyethyltrichlorogermane?

The Canonical SMILES of Carboxyethyltrichlorogermane is C(C[Ge](Cl)(Cl)Cl)C(=O)O.

What is the CAS number of Carboxyethyltrichlorogermane?

The CAS number of Carboxyethyltrichlorogermane is 15961-23-6.

What is the hydrogen bond donor count of Carboxyethyltrichlorogermane?

The hydrogen bond donor count of Carboxyethyltrichlorogermane is 1.

What is the hydrogen bond acceptor count of Carboxyethyltrichlorogermane?

The hydrogen bond acceptor count of Carboxyethyltrichlorogermane is 2.

Is Carboxyethyltrichlorogermane canonicalized?

Yes, Carboxyethyltrichlorogermane is canonicalized according to PubChem.