6-Bromo-2-isopropylquinoline-4-carboxylic acid

• CAS: 401624-46-2
• Catalog Number: ACM401624462
• Category: Bromine Series
• Molecular Weight: 294.14
• Molecular Formula: C₁₃H₁₂BrNO₂
• Synonyms: AKOS AUF0612;6-BROMO-2-ISOPROPYL-QUINOLINE-4-CARBOXYLIC ACID

Custom Q&A

What is the molecular formula of 6-Bromo-2-isopropylquinoline-4-carboxylic acid?

The molecular formula is C13H12BrNO2.

What is the molecular weight of 6-Bromo-2-isopropylquinoline-4-carboxylic acid?

The molecular weight is 294.14 g/mol.

What is the IUPAC name of 6-Bromo-2-isopropylquinoline-4-carboxylic acid?

The IUPAC name is 6-bromo-2-propan-2-ylquinoline-4-carboxylic acid.

What is the InChI of 6-Bromo-2-isopropylquinoline-4-carboxylic acid?

The InChI is InChI=1S/C13H12BrNO2/c1-7(2)12-6-10(13(16)17)9-5-8(14)3-4-11(9)15-12/h3-7H,1-2H3,(H,16,17).

What is the InChIKey of 6-Bromo-2-isopropylquinoline-4-carboxylic acid?

The InChIKey is QUBDAOYYNVYIBJ-UHFFFAOYSA-N.

What is the canonical SMILES of 6-Bromo-2-isopropylquinoline-4-carboxylic acid?

The canonical SMILES is CC(C)C1=NC2=C(C=C(C=C2)Br)C(=C1)C(=O)O.

What is the CAS number of 6-Bromo-2-isopropylquinoline-4-carboxylic acid?

The CAS number is 401624-46-2.

What is the hydrogen bond donor count of 6-Bromo-2-isopropylquinoline-4-carboxylic acid?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of 6-Bromo-2-isopropylquinoline-4-carboxylic acid?

The hydrogen bond acceptor count is 3.

What is the topological polar surface area of 6-Bromo-2-isopropylquinoline-4-carboxylic acid?

The topological polar surface area is 50.2Ų.