4-(4'-Aminomethyl)phenyl-1-N-boc-aniline

• Catalog Number: ACMA00002591
• Category: Ethers
• Molecular Weight: 298.38
• Molecular Formula: C₁₇H₂₅NO₆
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-(4'-Aminomethyl)phenyl-1-N-boc-aniline?

The molecular formula is C18H22N2O2.

What is the molecular weight of 4-(4'-Aminomethyl)phenyl-1-N-boc-aniline?

The molecular weight is 298.4 g/mol.

What is the IUPAC name of 4-(4'-Aminomethyl)phenyl-1-N-boc-aniline?

The IUPAC name is tert-butyl N-[4-[4-(aminomethyl)phenyl]phenyl]carbamate.

What is the Canonical SMILES of 4-(4'-Aminomethyl)phenyl-1-N-boc-aniline?

The Canonical SMILES is CC(C)(C)OC(=O)NC1=CC=C(C=C1)C2=CC=C(C=C2)CN.

What is the CAS number of 4-(4'-Aminomethyl)phenyl-1-N-boc-aniline?

The CAS number is 811842-12-3.

What is the European Community (EC) Number of 4-(4'-Aminomethyl)phenyl-1-N-boc-aniline?

The EC Number is 672-193-5.

What is the XLogP3-AA value of 4-(4'-Aminomethyl)phenyl-1-N-boc-aniline?

The XLogP3-AA value is 3.

How many hydrogen bond donor count does 4-(4'-Aminomethyl)phenyl-1-N-boc-aniline have?

It has 2 hydrogen bond donor counts.

How many rotatable bond count does 4-(4'-Aminomethyl)phenyl-1-N-boc-aniline have?

It has 5 rotatable bond counts.

Is the compound 4-(4'-Aminomethyl)phenyl-1-N-boc-aniline considered canonicalized?

Yes, the compound is canonicalized.