3-Chloro-2-fluoropyridine-4-boronicacidpinacolester

• CAS: 1073353-71-5
• Catalog Number: ACM1073353715
• Category: Boronic Esters
• Molecular Weight: 257.4967632
• Molecular Formula: C₁₁H₁₄BClFNO₂

Custom Q&A

What is the molecular formula of 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester?

The molecular formula is C11H14BClFNO2.

What is the molecular weight of 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester?

The molecular weight is 257.50 g/mol.

What is the IUPAC name of 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester?

The IUPAC name is 3-chloro-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.

What is the InChI of 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester?

The InChI is InChI=1S/C11H14BClFNO2/c1-10(2)11(3,4)17-12(16-10)7-5-6-15-9(14)8(7)13/h5-6H,1-4H3.

What is the InChIKey of 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester?

The InChIKey is GCFCLRRKQXUVJM-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester?

The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)F)Cl.

What is the CAS number of 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester?

The CAS number is 1073353-71-5.

How many hydrogen bond donor counts does 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester have?

It has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 3-Chloro-2-fluoropyridine-4-boronic acid pinacol ester have?

It has 1 rotatable bond count.