2-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid

• CAS: 915030-08-9
• Catalog Number: ACM915030089
• Category: Other Products
• Molecular Weight: 197
• Molecular Formula: C₅H₂F₃NO₂S
• Synonyms: 2-(TRIFLUOROMETHYL)-1,3-THIAZOLE-4-CARBOXYLIC ACID;2-(trifluoroMethyl)thiazole-4-carboxylic acid;4-Carboxy-2-(trifluoromethyl)-1,3-thiazole
• Hazard Statements: Xn
• Supplemental Hazard Statements: H302
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid?

Molecular formula: C5H2F3NO2S

What is the molecular weight of 2-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid?

Molecular weight: 197.14 g/mol

What is the IUPAC name of 2-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid?

IUPAC name: 2-(trifluoromethyl)-1,3-thiazole-4-carboxylic acid

What is the Canonical SMILES representation of 2-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid?

Canonical SMILES: C1=C(N=C(S1)C(F)(F)F)C(=O)O

How many hydrogen bond donor counts are there in 2-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid?

1 hydrogen bond donor count

How many hydrogen bond acceptor counts are there in 2-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid?

7 hydrogen bond acceptor counts

What is the exact mass of 2-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid?

Exact mass: 196.97583397 g/mol

What is the topological polar surface area of 2-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid?

Topological polar surface area: 78.4 Ų

How many heavy atoms are there in the molecular structure of 2-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid?

12 heavy atoms

Is 2-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid considered as a canonicalized compound?

Yes, the compound is canonicalized.