CAS
--- Purity
---
--- Purity
---
Shopping basket
2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid
Catalog Number
ACMA00002126
Category
Ethers
Molecular Weight
241.24
Molecular Formula
C11H15FN2O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid?
The molecular formula of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid is C11H15NO5.
What is the molecular weight of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid?
The molecular weight of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid is 241.24 g/mol.
What is the IUPAC name of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid?
The IUPAC name of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid is 2-amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid.
What is the InChI of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid?
The InChI of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid is InChI=1S/C11H15NO5/c1-15-3-4-17-10-6-8(12)7(11(13)14)5-9(10)16-2/h5-6H,3-4,12H2,1-2H3,(H,13,14).
What is the InChIKey of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid?
The InChIKey of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid is HITVTTWDAMHBTQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid?
The canonical SMILES of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid is COCCOC1=C(C=C(C(=C1)N)C(=O)O)OC.
What is the XLogP3-AA value of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid?
The XLogP3-AA value of 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid is 1.1.
How many hydrogen bond donor counts does 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid have?
2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid have?
2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid has 6 hydrogen bond acceptor counts.
How many rotatable bond counts does 2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid have?
2-Amino-5-methoxy-4-(2-methoxyethoxy)benzoic acid has 6 rotatable bond counts.
Recommended Products
![Ethyl 2-amino-3-carbamoyl-4,7-dihydro-5H-thieno[2,3-c]-pyridine-6-carboxylate](/v2/images/structure-default.jpg)
