CAS
823-54-1 Purity
97%
823-54-1 Purity
97%
Shopping basket
2-Amino-5-bromobenzoic acid
CAS
5794-88-7
Catalog Number
ACM5794887
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Amino-5-bromobenzoic acid?
The molecular formula of 2-Amino-5-bromobenzoic acid is C7H6BrNO2.
What is the molecular weight of 2-Amino-5-bromobenzoic acid?
The molecular weight of 2-Amino-5-bromobenzoic acid is 216.03 g/mol.
What is the IUPAC name of 2-Amino-5-bromobenzoic acid?
The IUPAC name of 2-Amino-5-bromobenzoic acid is 2-amino-5-bromobenzoic acid.
What is the InChI of 2-Amino-5-bromobenzoic acid?
The InChI of 2-Amino-5-bromobenzoic acid is InChI=1S/C7H6BrNO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11).
What is the InChIKey of 2-Amino-5-bromobenzoic acid?
The InChIKey of 2-Amino-5-bromobenzoic acid is CUKXRHLWPSBCTI-UHFFFAOYSA-N.
What is the CAS number of 2-Amino-5-bromobenzoic acid?
The CAS number of 2-Amino-5-bromobenzoic acid is 5794-88-7.
What is the XLogP3 value of 2-Amino-5-bromobenzoic acid?
The XLogP3 value of 2-Amino-5-bromobenzoic acid is 1.6.
How many hydrogen bond donor counts are there in 2-Amino-5-bromobenzoic acid?
There are 2 hydrogen bond donor counts in 2-Amino-5-bromobenzoic acid.
How many hydrogen bond acceptor counts are there in 2-Amino-5-bromobenzoic acid?
There are 3 hydrogen bond acceptor counts in 2-Amino-5-bromobenzoic acid.
Recommended Products
