2,5-Dimethoxybenzenesulfonyl fluoride

• CAS: 99365-89-6
• Catalog Number: ACM99365896
• Category: Other Fluorinated Organic Building Blocks
• Molecular Weight: 220.22
• Molecular Formula: C₆H₃Cl₂FO₂S
• Appearance: solid
• Hazard Statements: H302-H314
• RIDADR: UN 3261 8 / PGII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 2,5-Dimethoxybenzenesulfonyl fluoride?

The molecular formula of 2,5-Dimethoxybenzenesulfonyl fluoride is C8H9FO4S.

What is the molecular weight of 2,5-Dimethoxybenzenesulfonyl fluoride?

The molecular weight of 2,5-Dimethoxybenzenesulfonyl fluoride is 220.22 g/mol.

What are some synonyms of 2,5-Dimethoxybenzenesulfonyl fluoride?

Some synonyms of 2,5-Dimethoxybenzenesulfonyl fluoride are 2,5-dimethoxybenzene-1-sulfonyl fluoride, 99365-89-6, AKOS022542769, and DY-0053.

What is the InChIKey of 2,5-Dimethoxybenzenesulfonyl fluoride?

The InChIKey of 2,5-Dimethoxybenzenesulfonyl fluoride is HOHJQDUMZBLDDY-UHFFFAOYSA-N.

What is the Canonical SMILES representation of 2,5-Dimethoxybenzenesulfonyl fluoride?

The Canonical SMILES of 2,5-Dimethoxybenzenesulfonyl fluoride is COC1=CC(=C(C=C1)OC)S(=O)(=O)F.

What is the XLogP3 value of 2,5-Dimethoxybenzenesulfonyl fluoride?

The XLogP3 value of 2,5-Dimethoxybenzenesulfonyl fluoride is 1.3.

How many hydrogen bond acceptors are there in the structure of 2,5-Dimethoxybenzenesulfonyl fluoride?

There are 5 hydrogen bond acceptors in the structure of 2,5-Dimethoxybenzenesulfonyl fluoride.

What is the topological polar surface area of 2,5-Dimethoxybenzenesulfonyl fluoride?

The topological polar surface area of 2,5-Dimethoxybenzenesulfonyl fluoride is 61.2.

How many heavy atoms are present in the structure of 2,5-Dimethoxybenzenesulfonyl fluoride?

There are 14 heavy atoms present in the structure of 2,5-Dimethoxybenzenesulfonyl fluoride.

Is 2,5-Dimethoxybenzenesulfonyl fluoride a canonicalized compound?

Yes, 2,5-Dimethoxybenzenesulfonyl fluoride is a canonicalized compound according to PubChem.