2,5-Dichloropyridine-3-boronicacid

• CAS: 536693-97-7
• Catalog Number: ACM536693977
• Category: Boro-Amino Acids
• Molecular Weight: 191.81
• Molecular Formula: C₅H₄BCl₂NO₂
• Synonyms: 2,5-DICHLOROPYRIDINE-3-BORONIC ACID;(2,5-DICHLOROPYRIDIN-3-YL)BORONIC ACID

Custom Q&A

What is the molecular formula of 2,5-Dichloropyridine-3-boronic acid?

The molecular formula of 2,5-Dichloropyridine-3-boronic acid is C5H4BCl2NO2.

What is the molecular weight of 2,5-Dichloropyridine-3-boronic acid?

The molecular weight of 2,5-Dichloropyridine-3-boronic acid is 191.81 g/mol.

What is the IUPAC name of 2,5-Dichloropyridine-3-boronic acid?

The IUPAC name of 2,5-Dichloropyridine-3-boronic acid is (2,5-dichloropyridin-3-yl)boronic acid.

What is the InChI of 2,5-Dichloropyridine-3-boronic acid?

The InChI of 2,5-Dichloropyridine-3-boronic acid is InChI=1S/C5H4BCl2NO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H.

What is the InChIKey of 2,5-Dichloropyridine-3-boronic acid?

The InChIKey of 2,5-Dichloropyridine-3-boronic acid is IISUHTJFLBUMKT-UHFFFAOYSA-N.

What is the canonical SMILES of 2,5-Dichloropyridine-3-boronic acid?

The canonical SMILES of 2,5-Dichloropyridine-3-boronic acid is B(C1=CC(=CN=C1Cl)Cl)(O)O.

What is the CAS number of 2,5-Dichloropyridine-3-boronic acid?

The CAS number of 2,5-Dichloropyridine-3-boronic acid is 536693-97-7.

What is the ChEMBL ID of 2,5-Dichloropyridine-3-boronic acid?

The ChEMBL ID of 2,5-Dichloropyridine-3-boronic acid is CHEMBL3236925.

What is the hydrogen bond donor count of 2,5-Dichloropyridine-3-boronic acid?

The hydrogen bond donor count of 2,5-Dichloropyridine-3-boronic acid is 2.

Is 2,5-Dichloropyridine-3-boronic acid the canonical form?

Yes, 2,5-Dichloropyridine-3-boronic acid is the canonical form.