[2-(3-Methylbutoxy)phenyl]methanamine

• Catalog Number: ACMA00002224
• Category: Ethers
• Molecular Weight: 193.29
• Molecular Formula: C₁₂H₁₈N₂O₂
• Hazard Statements: H302
• RIDADR: UN 3082 9 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of [2-(3-Methylbutoxy)phenyl]methanamine?

The molecular formula is C12H19NO.

What is the molecular weight of [2-(3-Methylbutoxy)phenyl]methanamine?

The molecular weight is 193.28 g/mol.

What is the IUPAC name of [2-(3-Methylbutoxy)phenyl]methanamine?

The IUPAC name is [2-(3-methylbutoxy)phenyl]methanamine.

What is the InChI of [2-(3-Methylbutoxy)phenyl]methanamine?

The InChI is InChI=1S/C12H19NO/c1-10(2)7-8-14-12-6-4-3-5-11(12)9-13/h3-6,10H,7-9,13H2,1-2H3.

What is the InChIKey of [2-(3-Methylbutoxy)phenyl]methanamine?

The InChIKey is VFGAFGJOOSZYOJ-UHFFFAOYSA-N.

What is the canonical SMILES of [2-(3-Methylbutoxy)phenyl]methanamine?

The canonical SMILES is CC(C)CCOC1=CC=CC=C1CN.

What is the XLogP3-AA value of [2-(3-Methylbutoxy)phenyl]methanamine?

The XLogP3-AA value is 2.4.

How many hydrogen bond donor counts does [2-(3-Methylbutoxy)phenyl]methanamine have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does [2-(3-Methylbutoxy)phenyl]methanamine have?

It has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does [2-(3-Methylbutoxy)phenyl]methanamine have?

It has 5 rotatable bond counts.