2-(3-Fluorophenyl)acetamide

• Catalog Number: ACMA00001886
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 153.15
• Molecular Formula: C₇H₅ClFNO₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-(3-fluorophenyl)acetamide?

The molecular formula is C8H8FNO.

What is the molecular weight of 2-(3-fluorophenyl)acetamide?

The molecular weight is 153.15 g/mol.

When was 2-(3-fluorophenyl)acetamide first created?

It was first created on February 7, 2007.

What is the IUPAC name of 2-(3-fluorophenyl)acetamide?

The IUPAC name is 2-(3-fluorophenyl)acetamide.

What is the InChI of 2-(3-fluorophenyl)acetamide?

The InChI is InChI=1S/C8H8FNO/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H2,10,11).

How many hydrogen bond donor counts does 2-(3-fluorophenyl)acetamide have?

It has 1 hydrogen bond donor count.

What is the exact mass of 2-(3-fluorophenyl)acetamide?

The exact mass is 153.058992041 g/mol.

How many rotatable bond counts does 2-(3-fluorophenyl)acetamide have?

It has 2 rotatable bond counts.

What is the topological polar surface area of 2-(3-fluorophenyl)acetamide?

The topological polar surface area is 43.1 Ų.

Is 2-(3-fluorophenyl)acetamide considered canonicalized?

Yes, the compound is canonicalized.