CAS
1451393-10-4 Purity
---
1451393-10-4 Purity
---
Shopping basket
1-Isoquinolylboronic acid
CAS
1219080-58-6
Catalog Number
ACM1219080586
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-Isoquinolylboronic acid?
The molecular formula of 1-Isoquinolylboronic acid is C9H8BNO2.
What is the molecular weight of 1-Isoquinolylboronic acid?
The molecular weight of 1-Isoquinolylboronic acid is 172.98 g/mol.
What is the IUPAC name of 1-Isoquinolylboronic acid?
The IUPAC name of 1-Isoquinolylboronic acid is isoquinolin-1-ylboronic acid.
What is the InChI key of 1-Isoquinolylboronic acid?
The InChI key of 1-Isoquinolylboronic acid is RVUIQFODKHOTHQ-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Isoquinolylboronic acid?
The canonical SMILES of 1-Isoquinolylboronic acid is B(C1=NC=CC2=CC=CC=C12)(O)O.
How many hydrogen bond donor counts does 1-Isoquinolylboronic acid have?
1-Isoquinolylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 1-Isoquinolylboronic acid have?
1-Isoquinolylboronic acid has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 1-Isoquinolylboronic acid have?
1-Isoquinolylboronic acid has 1 rotatable bond count.
What is the topological polar surface area of 1-Isoquinolylboronic acid?
The topological polar surface area of 1-Isoquinolylboronic acid is 53.4Ų.
How many heavy atom counts does 1-Isoquinolylboronic acid have?
1-Isoquinolylboronic acid has 13 heavy atom counts.
Please kindly note that our products are for research use only.
Recommended Products
