| Catalog | OFC2043361324 |
| CAS | 2043361-32-4 |
| Category | Nucleophilic Fluorination Agents |
| Synonyms | 1,3-Bis(2,6-Diisopropylphenyl)-2-Fluoro-1H-Imidazol-3-Ium Tetrafluoroborate |
| Purity | >97.0%(N) |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2-fluoroimidazol-1-ium;tetrafluoroborate |
| InChI | InChI=1S/C27H36FN2.BF4/c1-17(2)21-11-9-12-22(18(3)4)25(21)29-15-16-30(27(29)28)26-23(19(5)6)13-10-14-24(26)20(7)8;2-1(3,4)5/h9-20H,1-8H3;/q+1;-1 |
| InChI Key | ZXIKPDSPOFQTLH-UHFFFAOYSA-N |
| Isomeric SMILES | [B-](F)(F)(F)F.CC(C)C1=C(C(=CC=C1)C(C)C)N2C=C[N+](=C2F)C3=C(C=CC=C3C(C)C)C(C)C |
| EC Number | 833-573-8 |
| Molecular Formula | C27H36BF5N2 |
| Molecular Weight | 494.40 |
| Appearance | White to orange to green powder to crystal |
| Storage | Store under inert gas |
| Stability | Moisture sensitive |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 6 |
| Exact Mass | 494.2891701 g/mol |
| Monoisotopic Mass | 494.2891701 g/mol |
| Topological Polar Surface Area | 8.8Ų |
| Heavy Atom Count | 35 |
| Formal Charge | 0 |
| Complexity | 472 |
| HS Number | 2933.29.4300 |
Please kindly note that our products and services are for research use only.