| Catalog | OFC1006376631 |
| CAS | 1006376-63-1 |
| Category | Fluorinated Cyclic Ethers |
| Synonyms | (S)-2-(3,4-Difluorophenyl)oxirane |
| Purity | tech |
| MDL Number | MFCD23142999 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | (2S)-2-(3,4-difluorophenyl)oxirane |
| InChI | InChI=1S/C8H6F2O/c9-6-2-1-5(3-7(6)10)8-4-11-8/h1-3,8H,4H2/t8-/m1/s1 |
| InChI Key | UNJRFWWCCAHSRB-MRVPVSSYSA-N |
| Isomeric SMILES | C1[C@@H](O1)C2=CC(=C(C=C2)F)F |
| Molecular Formula | C8H6F2O |
| Molecular Weight | 156.13 |
| XLogP3-AA | 1.6 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 156.03867113 g/mol |
| Monoisotopic Mass | 156.03867113 g/mol |
| Topological Polar Surface Area | 12.5Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 151 |
Please kindly note that our products and services are for research use only.