| Catalog | OFC2043472-1 |
| CAS | 2043-47-2 |
| Category | Perfluoroalkylation Agents |
| Synonyms | 1H,1H,2H,2H-Perfluorohexan-1-ol |
| Purity | 97% |
| MDL Number | MFCD00039543 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol |
| InChI | InChI=1S/C6H5F9O/c7-3(8,1-2-16)4(9,10)5(11,12)6(13,14)15/h16H,1-2H2 |
| InChI Key | JCMNMOBHVPONLD-UHFFFAOYSA-N |
| Isomeric SMILES | C(CO)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
| EC Number | 218-050-9 |
| Molecular Formula | C6H5F9O |
| Molecular Weight | 264.09 |
| Boiling Point | 140-143 °C(lit.) |
| Density | 1.59 g/mL at 25 °C(lit.) |
| Refractive Index | 1.314 |
| Appearance | Colorless liquid |
| Storage | Keep in dark place, inert atmosphere, 2-8°C |
| Stability | Hygroscopic |
| XLogP3-AA | 3 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 4 |
| Exact Mass | 264.01966824 g/mol |
| Monoisotopic Mass | 264.01966824 g/mol |
| Topological Polar Surface Area | 20.2Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 243 |
| HS Number | 29055900 |
Please kindly note that our products and services are for research use only.