| Catalog | OFC156241417-1 |
| CAS | 156241-41-7 |
| Category | Trifluoromethylation Agents |
| Synonyms | Trifluoromethanesulfonic Acid 1,1,1,3,3,3-Hexafluoroisopropyl Ester; 1,1,1,3,3,3-Hexafluoroisopropyl Triflate |
| Purity | >97% |
| MDL Number | MFCD02093340 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl trifluoromethanesulfonate |
| InChI | InChI=1S/C4HF9O3S/c5-2(6,7)1(3(8,9)10)16-17(14,15)4(11,12)13/h1H |
| InChI Key | NRHQWNHARTXNOE-UHFFFAOYSA-N |
| Isomeric SMILES | C(C(F)(F)F)(C(F)(F)F)OS(=O)(=O)C(F)(F)F |
| EC Number | 674-870-0 |
| Reaxys Registry Number | 5064178 |
| Molecular Formula | C4HF9O3S |
| Molecular Weight | 300.10 |
| Specific Gravity | 1.67 |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Keep in dark place, inert atmosphere, room temperature |
| Stability | Moisture sensitive |
| XLogP3-AA | 3.2 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 12 |
| Rotatable Bond Count | 2 |
| Exact Mass | 299.95026852 g/mol |
| Monoisotopic Mass | 299.95026852 g/mol |
| Topological Polar Surface Area | 51.8Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 340 |
| HS Number | 2904.99.5000 |
Please kindly note that our products and services are for research use only.