What is the molecular formula of 2-Fluoro-4-methylaniline?
The molecular formula of 2-Fluoro-4-methylaniline is C7H8FN.
What is the molecular weight of 2-Fluoro-4-methylaniline?
The molecular weight of 2-Fluoro-4-methylaniline is 125.14 g/mol.
What is the IUPAC name of 2-Fluoro-4-methylaniline?
The IUPAC name of 2-Fluoro-4-methylaniline is 2-fluoro-4-methylaniline.
What is the InChI of 2-Fluoro-4-methylaniline?
The InChI of 2-Fluoro-4-methylaniline is InChI=1S/C7H8FN/c1-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3.
What is the InChIKey of 2-Fluoro-4-methylaniline?
The InChIKey of 2-Fluoro-4-methylaniline is ZQEXBVHABAJPHJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoro-4-methylaniline?
The canonical SMILES of 2-Fluoro-4-methylaniline is CC1=CC(=C(C=C1)N)F.
What is the CAS number of 2-Fluoro-4-methylaniline?
The CAS number of 2-Fluoro-4-methylaniline is 452-80-2.
What is the UNII of 2-Fluoro-4-methylaniline?
The UNII of 2-Fluoro-4-methylaniline is Z6EGC62G32.
Is 2-Fluoro-4-methylaniline a covalently-bonded unit?
Yes, 2-Fluoro-4-methylaniline is a covalently-bonded unit.