What is the molecular formula of 2-Fluoro-5-methylaniline?
The molecular formula of 2-Fluoro-5-methylaniline is C7H8FN.
What is the molecular weight of 2-Fluoro-5-methylaniline?
The molecular weight of 2-Fluoro-5-methylaniline is 125.14 g/mol.
What is the IUPAC name of 2-Fluoro-5-methylaniline?
The IUPAC name of 2-Fluoro-5-methylaniline is 2-fluoro-5-methylaniline.
Can you provide the InChI of 2-Fluoro-5-methylaniline?
The InChI of 2-Fluoro-5-methylaniline is InChI=1S/C7H8FN/c1-5-2-3-6(8)7(9)4-5/h2-4H,9H2,1H3.
What is the Canonical SMILES representation of 2-Fluoro-5-methylaniline?
The Canonical SMILES representation of 2-Fluoro-5-methylaniline is CC1=CC(=C(C=C1)F)N.
What is the CAS number of 2-Fluoro-5-methylaniline?
The CAS number of 2-Fluoro-5-methylaniline is 452-84-6.
How many hydrogen bond donor counts are there in 2-Fluoro-5-methylaniline?
There is one hydrogen bond donor count in 2-Fluoro-5-methylaniline.
What is the topological polar surface area of 2-Fluoro-5-methylaniline?
The topological polar surface area of 2-Fluoro-5-methylaniline is 26.2.
How many heavy atoms are present in 2-Fluoro-5-methylaniline?
There are 9 heavy atoms in 2-Fluoro-5-methylaniline.
Is 2-Fluoro-5-methylaniline a canonicalized compound?
Yes, 2-Fluoro-5-methylaniline is a canonicalized compound.