What is the molecular formula of 4-Fluoro-3-methylaniline?
The molecular formula of 4-Fluoro-3-methylaniline is C7H8FN.
What is the molecular weight of 4-Fluoro-3-methylaniline?
The molecular weight of 4-Fluoro-3-methylaniline is 125.14 g/mol.
What is the IUPAC name of 4-Fluoro-3-methylaniline?
The IUPAC name of 4-Fluoro-3-methylaniline is 4-fluoro-3-methylaniline.
What is the InChI of 4-Fluoro-3-methylaniline?
The InChI of 4-Fluoro-3-methylaniline is InChI=1S/C7H8FN/c1-5-4-6(9)2-3-7(5)8/h2-4H,9H2,1H3.
What is the InChIKey of 4-Fluoro-3-methylaniline?
The InChIKey of 4-Fluoro-3-methylaniline is NYMDPDNETOLVBS-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Fluoro-3-methylaniline?
The canonical SMILES of 4-Fluoro-3-methylaniline is CC1=C(C=CC(=C1)N)F.
What is the CAS number of 4-Fluoro-3-methylaniline?
The CAS number of 4-Fluoro-3-methylaniline is 452-69-7.
What is the European Community (EC) number of 4-Fluoro-3-methylaniline?
The European Community (EC) number of 4-Fluoro-3-methylaniline is 207-207-7.
What is the UNII (FDA Global Substance Registration System) number of 4-Fluoro-3-methylaniline?
The UNII (FDA Global Substance Registration System) number of 4-Fluoro-3-methylaniline is SHJ88XWX75.
What is the molecular weight of 4-Fluoro-3-methylaniline according to PubChem?
The molecular weight of 4-Fluoro-3-methylaniline according to PubChem is 125.14 g/mol.