What is the molecular formula of 2,3-Difluoroaniline?
The molecular formula is C6H5F2N.
What is the molecular weight of 2,3-Difluoroaniline?
The molecular weight is 129.11 g/mol.
What is the IUPAC name of 2,3-Difluoroaniline?
The IUPAC name is 2,3-difluoroaniline.
What is the InChI of 2,3-Difluoroaniline?
The InChI is InChI=1S/C6H5F2N/c7-4-2-1-3-5(9)6(4)8/h1-3H,9H2.
What is the InChIKey of 2,3-Difluoroaniline?
The InChIKey is YCCQGFYAVUTQFK-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Difluoroaniline?
The canonical SMILES is C1=CC(=C(C(=C1)F)F)N.
What is the CAS number of 2,3-Difluoroaniline?
The CAS number is 4519-40-8.
What is the European Community (EC) number of 2,3-Difluoroaniline?
The European Community (EC) number is 224-847-2.
What is the DSSTox Substance ID of 2,3-Difluoroaniline?
The DSSTox Substance ID is DTXSID80196415.
Is 2,3-Difluoroaniline a covalently-bonded unit?
Yes, 2,3-Difluoroaniline is a covalently-bonded unit.