What is the molecular formula of 2-Amino-3-fluorophenol?
The molecular formula of 2-Amino-3-fluorophenol is C6H6FNO.
What is the molecular weight of 2-Amino-3-fluorophenol?
The molecular weight of 2-Amino-3-fluorophenol is 127.12 g/mol.
What is the IUPAC name of 2-Amino-3-fluorophenol?
The IUPAC name of 2-Amino-3-fluorophenol is 2-amino-3-fluorophenol.
What is the InChI of 2-Amino-3-fluorophenol?
The InChI of 2-Amino-3-fluorophenol is InChI=1S/C6H6FNO/c7-4-2-1-3-5(9)6(4)8/h1-3,9H,8H2.
What is the InChIKey of 2-Amino-3-fluorophenol?
The InChIKey of 2-Amino-3-fluorophenol is QOZLOYKAFDTQNU-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-3-fluorophenol?
The canonical SMILES of 2-Amino-3-fluorophenol is C1=CC(=C(C(=C1)F)N)O.
What is the CAS number of 2-Amino-3-fluorophenol?
The CAS number of 2-Amino-3-fluorophenol is 53981-23-0.
What is the EC number of 2-Amino-3-fluorophenol?
The EC number of 2-Amino-3-fluorophenol is 812-841-8.
What is the molecular weight of 2-Amino-3-fluorophenol according to PubChem?
The molecular weight of 2-Amino-3-fluorophenol is 127.12 g/mol according to PubChem.
Is 2-Amino-3-fluorophenol a canonicalized compound?
Yes, 2-Amino-3-fluorophenol is a canonicalized compound according to PubChem.