What is the PubChem CID of 2-Amino-3-iodo-phenol?
PubChem CID 24721631.
What is the molecular formula of 2-Amino-3-iodo-phenol?
The molecular formula is C6H6INO.
What is the molecular weight of 2-Amino-3-iodo-phenol?
The molecular weight is 235.02 g/mol.
What is the IUPAC name of 2-Amino-3-iodo-phenol?
The IUPAC name is 2-amino-3-iodophenol.
What is the InChI of 2-Amino-3-iodo-phenol?
The InChI is InChI=1S/C6H6INO/c7-4-2-1-3-5(9)6(4)8/h1-3,9H,8H2.
What is the InChIKey of 2-Amino-3-iodo-phenol?
The InChIKey is VMFLCURUMAEIAO-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-3-iodo-phenol?
The canonical SMILES is C1=CC(=C(C(=C1)I)N)O.
What is the CAS number of 2-Amino-3-iodo-phenol?
The CAS number is 443921-86-6.
What is the European Community (EC) number of 2-Amino-3-iodo-phenol?
The European Community (EC) number is 675-859-3.
Is 2-Amino-3-iodo-phenol canonicalized?
Yes, 2-Amino-3-iodo-phenol is canonicalized according to PubChem.