What is the molecular formula of 3-Fluoro-2-nitroaniline?
The molecular formula of 3-Fluoro-2-nitroaniline is C6H5FN2O2.
What is the molecular weight of 3-Fluoro-2-nitroaniline?
The molecular weight of 3-Fluoro-2-nitroaniline is 156.11 g/mol.
When was the compound created?
The compound was created on July 19, 2005.
When was the compound last modified?
The compound was last modified on November 25, 2023.
What is the IUPAC name of 3-Fluoro-2-nitroaniline?
The IUPAC name of 3-Fluoro-2-nitroaniline is 3-fluoro-2-nitroaniline.
What is the InChI of 3-Fluoro-2-nitroaniline?
The InChI of 3-Fluoro-2-nitroaniline is InChI=1S/C6H5FN2O2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H,8H2.
What is the InChIKey of 3-Fluoro-2-nitroaniline?
The InChIKey of 3-Fluoro-2-nitroaniline is NSFGNLQLWFZHKK-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluoro-2-nitroaniline?
The canonical SMILES of 3-Fluoro-2-nitroaniline is C1=CC(=C(C(=C1)F)[N+](=O)[O-])N.
What is the CAS number of 3-Fluoro-2-nitroaniline?
The CAS number of 3-Fluoro-2-nitroaniline is 567-63-5.
What is the XLogP3-AA value of 3-Fluoro-2-nitroaniline?
The XLogP3-AA value of 3-Fluoro-2-nitroaniline is 1.7.