What is the molecular formula of 2-Bromo-3-fluoroaniline?
The molecular formula of 2-Bromo-3-fluoroaniline is C6H5BrFN.
What is the molecular weight of 2-Bromo-3-fluoroaniline?
The molecular weight of 2-Bromo-3-fluoroaniline is 190.01 g/mol.
What is the IUPAC name of 2-Bromo-3-fluoroaniline?
The IUPAC name of 2-Bromo-3-fluoroaniline is 2-bromo-3-fluoroaniline.
What is the InChI of 2-Bromo-3-fluoroaniline?
The InChI of 2-Bromo-3-fluoroaniline is InChI=1S/C6H5BrFN/c7-6-4(8)2-1-3-5(6)9/h1-3H,9H2.
What is the InChIKey of 2-Bromo-3-fluoroaniline?
The InChIKey of 2-Bromo-3-fluoroaniline is XZRSXRUYZXBTGD-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-3-fluoroaniline?
The canonical SMILES of 2-Bromo-3-fluoroaniline is C1=CC(=C(C(=C1)F)Br)N.
What is the CAS number of 2-Bromo-3-fluoroaniline?
The CAS number of 2-Bromo-3-fluoroaniline is 111721-75-6.
What is the European Community (EC) Number of 2-Bromo-3-fluoroaniline?
The European Community (EC) Number of 2-Bromo-3-fluoroaniline is 676-172-1.
What is the DSSTox Substance ID of 2-Bromo-3-fluoroaniline?
The DSSTox Substance ID of 2-Bromo-3-fluoroaniline is DTXSID10563838.
Is 2-Bromo-3-fluoroaniline a canonicalized compound?
Yes, 2-Bromo-3-fluoroaniline is a canonicalized compound.