What is the molecular formula of tridiphane?
The molecular formula of tridiphane is C10H7Cl5O.
What are the synonyms for tridiphane?
The synonyms for tridiphane are "Nelpon" and "Dowco 356".
What is the IUPAC name of tridiphane?
The IUPAC name of tridiphane is 2-(3,5-dichlorophenyl)-2-(2,2,2-trichloroethyl)oxirane.
What is the InChIKey of tridiphane?
The InChIKey of tridiphane is IBZHOAONZVJLOB-UHFFFAOYSA-N.
What is the canonical SMILES of tridiphane?
The canonical SMILES of tridiphane is C1C(O1)(CC(Cl)(Cl)Cl)C2=CC(=CC(=C2)Cl)Cl.
What is the CAS number of tridiphane?
The CAS number of tridiphane is 58138-08-2.
What is the XLogP3-AA value of tridiphane?
The XLogP3-AA value of tridiphane is 4.7.
How many hydrogen bond donor count does tridiphane have?
Tridiphane has 0 hydrogen bond donor count.
How many rotatable bond count does tridiphane have?
Tridiphane has 2 rotatable bond count.
Is tridiphane a covalently-bonded unit?
Yes, tridiphane is a covalently-bonded unit.