What is the molecular formula of D-Theanine?
The molecular formula of D-Theanine is C7H14N2O3.
What are the synonyms of D-Theanine?
The synonyms of D-Theanine are 5822-62-8, (2R)-2-amino-5-(ethylamino)-5-oxopentanoic acid, SCHEMBL4906383, and DTXSID60433375.
How is the molecular weight of D-Theanine computed?
The molecular weight of D-Theanine is computed by PubChem 2.1.
When was D-Theanine created and modified?
D-Theanine was created on October 25, 2006, and last modified on October 21, 2023.
What is the IUPAC name of D-Theanine?
The IUPAC name of D-Theanine is (2R)-2-amino-5-(ethylamino)-5-oxopentanoic acid.
What is the InChI of D-Theanine?
The InChI of D-Theanine is InChI=1S/C7H14N2O3/c1-2-9-6(10)4-3-5(8)7(11)12/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t5-/m1/s1.
What is the InChIKey of D-Theanine?
The InChIKey of D-Theanine is DATAGRPVKZEWHA-RXMQYKEDSA-N.
What are the canonical and isomeric SMILES of D-Theanine?
The canonical SMILES of D-Theanine is CCNC(=O)CCC(C(=O)O)N, and the isomeric SMILES is CCNC(=O)CC[C@H](C(=O)O)N.
What is the CAS number of D-Theanine?
The CAS number of D-Theanine is 5822-62-8.
What is the XLogP3 value of D-Theanine?
The XLogP3 value of D-Theanine is -3.6.