What is the molecular formula of Mono[2-(perfluorohexyl)ethyl] phosphate?
The molecular formula is C6F13CH2CH2OP(=O)(OH)2C8H6F13O4P.
What are some synonyms for Mono[2-(perfluorohexyl)ethyl] phosphate?
Some synonyms include perfluorooctyl phosphate, 57678-01-0, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl dihydrogen phosphate, and 6:2 Fluorotelomer phosphate monoester.
What is the molecular weight of Mono[2-(perfluorohexyl)ethyl] phosphate?
The molecular weight is 444.08 g/mol.
When was Mono[2-(perfluorohexyl)ethyl] phosphate created?
It was created on February 9, 2007.
Is Mono[2-(perfluorohexyl)ethyl] phosphate an environmental contaminant?
Yes, it has a role as an environmental contaminant.
What is the IUPAC name of Mono[2-(perfluorohexyl)ethyl] phosphate?
The IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl dihydrogen phosphate.
What is the InChI of Mono[2-(perfluorohexyl)ethyl] phosphate?
The InChI is "InChI=1S/C8H6F13O4P/c9-3(10,1-2-25-26(22,23)24)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1-2H2,(H2,22,23,24)".
What is the InChIKey of Mono[2-(perfluorohexyl)ethyl] phosphate?
The InChIKey is "FZTRDYSPWWJCOF-UHFFFAOYSA-N".
What is the Canonical SMILES of Mono[2-(perfluorohexyl)ethyl] phosphate?
The Canonical SMILES is "C(COP(=O)(O)O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F".
What is the CAS number of Mono[2-(perfluorohexyl)ethyl] phosphate?
The CAS number is 57678-01-0.