What is the molecular formula of girinimbine?
The molecular formula of girinimbine is C18H17NO.
What is the molecular weight of girinimbine?
The molecular weight of girinimbine is 263.3 g/mol.
What is the IUPAC name of girinimbine?
The IUPAC name of girinimbine is 3,3,5-trimethyl-11H-pyrano[3,2-a]carbazole.
What is the InChIKey of girinimbine?
The InChIKey of girinimbine is GAEQWKVGMHUUKO-UHFFFAOYSA-N.
What is the Canonical SMILES of girinimbine?
The Canonical SMILES of girinimbine is CC1=CC2=C(C3=C1OC(C=C3)(C)C)NC4=CC=CC=C42.
What is the CAS number of girinimbine?
The CAS number of girinimbine is 23095-44-5.
What is the UNII of girinimbine?
The UNII of girinimbine is WH639V7QSF.
What is the Melting Point of girinimbine?
The Melting Point of girinimbine is 175 °C.
What is the physical description of girinimbine?
Girinimbine is in solid form.
What is the complexity of girinimbine?
The complexity of girinimbine is 416.