What is the molecular formula of N-Acetyl-S-(3-hydroxypropyl)cysteine?
The molecular formula is C8H15NO4S.
What are the synonyms for N-Acetyl-S-(3-hydroxypropyl)cysteine?
The synonyms are N-Acetyl-S-(3-hydroxypropyl)cysteine, 23127-40-4, S-(3-Hydroxypropyl)cysteine N-acetate, and L-Cysteine, N-acetyl-S-(3-hydroxypropyl)-.
What is the molecular weight of N-Acetyl-S-(3-hydroxypropyl)cysteine?
The molecular weight is 221.28 g/mol.
When was N-Acetyl-S-(3-hydroxypropyl)cysteine created and modified?
It was created on August 8, 2005, and modified on October 21, 2023.
What is the description of N-Acetyl-S-(3-hydroxypropyl)cysteine?
N-Acetyl-S-(3-hydroxypropyl)cysteine is a N-acyl-L-amino acid.
What is the structure of N-Acetyl-S-(3-hydroxypropyl)cysteine?
The structure can be viewed at the following link: https://pubchem.ncbi.nlm.nih.gov/image/imgsrv.fcgi?cid=119083&t=l
What is the IUPAC name of N-Acetyl-S-(3-hydroxypropyl)cysteine?
The IUPAC name is (2R)-2-acetamido-3-(3-hydroxypropylsulfanyl)propanoic acid.
What is the InChI of N-Acetyl-S-(3-hydroxypropyl)cysteine?
The InChI is InChI=1S/C8H15NO4S/c1-6(11)9-7(8(12)13)5-14-4-2-3-10/h7,10H,2-5H2,1H3,(H,9,11)(H,12,13)/t7-/m0/s1.
What is the InChIKey of N-Acetyl-S-(3-hydroxypropyl)cysteine?
The InChIKey is FMWPQZPFBAHHMB-ZETCQYMHSA-N.
What is the CAS number of N-Acetyl-S-(3-hydroxypropyl)cysteine?
The CAS number is 23127-40-4.
※ Please kindly note that our products are for research use only.