What is the molecular formula of octyl octanoate?
The molecular formula of octyl octanoate is C16H32O2.
What are some synonyms of octyl octanoate?
Some synonyms of octyl octanoate include octyl caprylate, n-octyl caprylate, and octanoic acid, octyl ester.
What is the molecular weight of octyl octanoate?
The molecular weight of octyl octanoate is 256.42 g/mol.
Is octyl octanoate a natural product?
Yes, octyl octanoate is a natural product found in Mandragora officinarum and Mandragora autumnalis.
What is the IUPAC name of octyl octanoate?
The IUPAC name of octyl octanoate is octyl octanoate.
What is the InChI of octyl octanoate?
The InChI of octyl octanoate is InChI=1S/C16H32O2/c1-3-5-7-9-11-13-15-18-16(17)14-12-10-8-6-4-2/h3-15H2,1-2H3.
What is the InChIKey of octyl octanoate?
The InChIKey of octyl octanoate is DJNTZVRUYMHBTD-UHFFFAOYSA-N.
What is the CAS number of octyl octanoate?
The CAS number of octyl octanoate is 2306-88-9.
What is the EC number of octyl octanoate?
The EC number of octyl octanoate is 218-980-5.
What is the density of octyl octanoate?
The reference does not provide information about the density of octyl octanoate.