What is the PubChem CID of 2,3-Dichlorobenzylamine?
PubChem CID 587625.
What is the molecular formula of 2,3-Dichlorobenzylamine?
The molecular formula is C7H7Cl2N.
What is the molecular weight of 2,3-Dichlorobenzylamine?
The molecular weight is 176.04 g/mol.
What is the IUPAC name of 2,3-Dichlorobenzylamine?
The IUPAC name is (2,3-dichlorophenyl)methanamine.
What is the InChI of 2,3-Dichlorobenzylamine?
The InChI is InChI=1S/C7H7Cl2N/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2.
What is the InChIKey of 2,3-Dichlorobenzylamine?
The InChIKey is JHBVZGONNIVXFJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Dichlorobenzylamine?
The canonical SMILES is C1=CC(=C(C(=C1)Cl)Cl)CN.
What is the CAS number of 2,3-Dichlorobenzylamine?
The CAS number is 39226-95-4.
What is the European Community (EC) number of 2,3-Dichlorobenzylamine?
The EC number is 625-018-1.
Is 2,3-Dichlorobenzylamine a canonicalized compound in PubChem?
Yes, 2,3-Dichlorobenzylamine is a canonicalized compound in PubChem.