What is the molecular formula of 4-Decylaniline?
The molecular formula of 4-Decylaniline is C16H27N.
What is the molecular weight of 4-Decylaniline?
The molecular weight of 4-Decylaniline is 233.39 g/mol.
What is the IUPAC name of 4-Decylaniline?
The IUPAC name of 4-Decylaniline is 4-decylaniline.
What is the InChI of 4-Decylaniline?
The InChI of 4-Decylaniline is InChI=1S/C16H27N/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15/h11-14H,2-10,17H2,1H3.
What is the InChIKey of 4-Decylaniline?
The InChIKey of 4-Decylaniline is WGENWPANMZLPIH-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Decylaniline?
The canonical SMILES of 4-Decylaniline is CCCCCCCCCCC1=CC=C(C=C1)N.
What is the CAS number of 4-Decylaniline?
The CAS number of 4-Decylaniline is 37529-30-9.
What is the EC number of 4-Decylaniline?
The EC number of 4-Decylaniline is 253-546-9.
What is the UNII of 4-Decylaniline?
The UNII of 4-Decylaniline is 25X74W976X.
Is 4-Decylaniline a canonicalized compound?
Yes, 4-Decylaniline is a canonicalized compound according to PubChem.