What is the molecular formula of 2-Chloro-4-iodoaniline?
The molecular formula of 2-Chloro-4-iodoaniline is C6H5ClIN.
What is the molecular weight of 2-Chloro-4-iodoaniline?
The molecular weight of 2-Chloro-4-iodoaniline is 253.47 g/mol.
What is the IUPAC name of 2-Chloro-4-iodoaniline?
The IUPAC name of 2-Chloro-4-iodoaniline is 2-chloro-4-iodoaniline.
What is the InChI of 2-Chloro-4-iodoaniline?
The InChI of 2-Chloro-4-iodoaniline is InChI=1S/C6H5ClIN/c7-5-3-4(8)1-2-6(5)9/h1-3H,9H2.
What is the InChIKey of 2-Chloro-4-iodoaniline?
The InChIKey of 2-Chloro-4-iodoaniline is MYDAOWXYGPEPJT-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-4-iodoaniline?
The canonical SMILES of 2-Chloro-4-iodoaniline is C1=CC(=C(C=C1I)Cl)N.
What is the CAS number of 2-Chloro-4-iodoaniline?
The CAS number of 2-Chloro-4-iodoaniline is 42016-93-3.
What is the EC number of 2-Chloro-4-iodoaniline?
The EC number of 2-Chloro-4-iodoaniline is 628-520-9.
What is the DSSTox Substance ID of 2-Chloro-4-iodoaniline?
The DSSTox Substance ID of 2-Chloro-4-iodoaniline is DTXSID40962158.
Is 2-Chloro-4-iodoaniline a canonicalized compound?
Yes, 2-Chloro-4-iodoaniline is a canonicalized compound according to PubChem.